C24H31NO2 — CID 12741873
1-(2-methoxyphenyl)-1-[1-(2-phenylethyl)piperidin-4-yl]butan-2-one (PubChem CID 12741873) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-1-[1-(2-phenylethyl)piperidin-4-yl]butan-2-one.
| Compound Name | 1-(2-methoxyphenyl)-1-[1-(2-phenylethyl)piperidin-4-yl]butan-2-one |
|---|---|
| PubChem CID | 12741873 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 1-(2-methoxyphenyl)-1-[1-(2-phenylethyl)piperidin-4-yl]butan-2-one |
| SMILES | CCC(=O)C(c1ccccc1OC)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H31NO2/c1-3-22(26)24(21-11-7-8-12-23(21)27-2)20-14-17-25(18-15-20)16-13-19-9-5-4-6-10-19/h4-12,20,24H,3,13-18H2,1-2H3 |
| InChIKey | BOOWLORNWNUTJZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |