C13H18FNO3 — CID 147693467
2-[(1-fluoropiperidin-4-yl)-hydroxymethyl]-6-methoxyphenol (PubChem CID 147693467) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is 2-[(1-fluoropiperidin-4-yl)-hydroxymethyl]-6-methoxyphenol.
| Compound Name | 2-[(1-fluoropiperidin-4-yl)-hydroxymethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 147693467 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2-[(1-fluoropiperidin-4-yl)-hydroxymethyl]-6-methoxyphenol |
| SMILES | COc1cccc(C(O)C2CCN(F)CC2)c1O |
| InChI | InChI=1S/C13H18FNO3/c1-18-11-4-2-3-10(13(11)17)12(16)9-5-7-15(14)8-6-9/h2-4,9,12,16-17H,5-8H2,1H3 |
| InChIKey | GRKNGVXZZWTXIO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|