C22H26FNO2 — CID 59915467
2-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]ethyl]-6-hydroxybenzaldehyde (PubChem CID 59915467) has the molecular formula C22H26FNO2 and a molecular weight of 355.45 g/mol. Its IUPAC name is 2-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]ethyl]-6-hydroxybenzaldehyde.
| Compound Name | 2-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]ethyl]-6-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 59915467 |
| Molecular Formula | C22H26FNO2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 2-[1-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]ethyl]-6-hydroxybenzaldehyde |
| SMILES | CC(c1cccc(O)c1C=O)C1CCN(CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H26FNO2/c1-16(20-3-2-4-22(26)21(20)15-25)18-10-13-24(14-11-18)12-9-17-5-7-19(23)8-6-17/h2-8,15-16,18,26H,9-14H2,1H3 |
| InChIKey | MGONHLMWYSRFRF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|