C29H34F2N3O+ — CID 19772092
carbamoyl-[(4-fluorophenyl)methyl]-[(4-fluorophenyl)-[1-(2-phenylethyl)piperidin-4-yl]methyl]-methylazanium (PubChem CID 19772092) has the molecular formula C29H34F2N3O+ and a molecular weight of 478.61 g/mol. Its IUPAC name is carbamoyl-[(4-fluorophenyl)methyl]-[(4-fluorophenyl)-[1-(2-phenylethyl)piperidin-4-yl]methyl]-methylazanium.
| Compound Name | carbamoyl-[(4-fluorophenyl)methyl]-[(4-fluorophenyl)-[1-(2-phenylethyl)piperidin-4-yl]methyl]-methylazanium |
|---|---|
| PubChem CID | 19772092 |
| Molecular Formula | C29H34F2N3O+ |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | carbamoyl-[(4-fluorophenyl)methyl]-[(4-fluorophenyl)-[1-(2-phenylethyl)piperidin-4-yl]methyl]-methylazanium |
| SMILES | C[N+](Cc1ccc(F)cc1)(C(N)=O)C(c1ccc(F)cc1)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C29H33F2N3O/c1-34(29(32)35,21-23-7-11-26(30)12-8-23)28(24-9-13-27(31)14-10-24)25-16-19-33(20-17-25)18-15-22-5-3-2-4-6-22/h2-14,25,28H,15-21H2,1H3,(H-,32,35)/p+1 |
| InChIKey | LVMMIGBMSNCUQP-UHFFFAOYSA-O |
| XLogP | 5.69 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|