C24H32FN3O — CID 56930892
1-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]-3-[1-(2-phenylethyl)piperidin-4-yl]urea (PubChem CID 56930892) has the molecular formula C24H32FN3O and a molecular weight of 397.54 g/mol. Its IUPAC name is 1-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]-3-[1-(2-phenylethyl)piperidin-4-yl]urea.
| Compound Name | 1-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]-3-[1-(2-phenylethyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 56930892 |
| Molecular Formula | C24H32FN3O |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 1-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]-3-[1-(2-phenylethyl)piperidin-4-yl]urea |
| SMILES | CC(C)[C@@H](NC(=O)NC1CCN(CCc2ccccc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H32FN3O/c1-18(2)23(20-8-10-21(25)11-9-20)27-24(29)26-22-13-16-28(17-14-22)15-12-19-6-4-3-5-7-19/h3-11,18,22-23H,12-17H2,1-2H3,(H2,26,27,29)/t23-/m1/s1 |
| InChIKey | DYGPHHIMORZMIH-HSZRJFAPSA-N |
| XLogP | 4.53 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |