C21H24FNO2 — CID 142039578
[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-(3-hydroxy-2-methylphenyl)methanone (PubChem CID 142039578) has the molecular formula C21H24FNO2 and a molecular weight of 341.43 g/mol. Its IUPAC name is [1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-(3-hydroxy-2-methylphenyl)methanone.
| Compound Name | [1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-(3-hydroxy-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 142039578 |
| Molecular Formula | C21H24FNO2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | [1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-(3-hydroxy-2-methylphenyl)methanone |
| SMILES | Cc1c(O)cccc1C(=O)C1CCN(CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H24FNO2/c1-15-19(3-2-4-20(15)24)21(25)17-10-13-23(14-11-17)12-9-16-5-7-18(22)8-6-16/h2-8,17,24H,9-14H2,1H3 |
| InChIKey | CYMYHJLYNWGAKP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |