C22H24FNO3 — CID 142039589
2-(4-fluorophenyl)-1-[4-(3-methoxy-2-methylbenzoyl)piperidin-1-yl]ethanone (PubChem CID 142039589) has the molecular formula C22H24FNO3 and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-[4-(3-methoxy-2-methylbenzoyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-fluorophenyl)-1-[4-(3-methoxy-2-methylbenzoyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 142039589 |
| Molecular Formula | C22H24FNO3 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-(4-fluorophenyl)-1-[4-(3-methoxy-2-methylbenzoyl)piperidin-1-yl]ethanone |
| SMILES | COc1cccc(C(=O)C2CCN(C(=O)Cc3ccc(F)cc3)CC2)c1C |
| InChI | InChI=1S/C22H24FNO3/c1-15-19(4-3-5-20(15)27-2)22(26)17-10-12-24(13-11-17)21(25)14-16-6-8-18(23)9-7-16/h3-9,17H,10-14H2,1-2H3 |
| InChIKey | KUCUYOIWAXMKEO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |