C14H15FLiNO3 — CID 21304004
lithium 1-[2-(4-fluorophenyl)acetyl]piperidine-4-carboxylate (PubChem CID 21304004) has the molecular formula C14H15FLiNO3 and a molecular weight of 271.22 g/mol. Its IUPAC name is lithium 1-[2-(4-fluorophenyl)acetyl]piperidine-4-carboxylate.
| Compound Name | lithium 1-[2-(4-fluorophenyl)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 21304004 |
| Molecular Formula | C14H15FLiNO3 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | lithium 1-[2-(4-fluorophenyl)acetyl]piperidine-4-carboxylate |
| SMILES | O=C([O-])C1CCN(C(=O)Cc2ccc(F)cc2)CC1.[Li+] |
| InChI | InChI=1S/C14H16FNO3.Li/c15-12-3-1-10(2-4-12)9-13(17)16-7-5-11(6-8-16)14(18)19;/h1-4,11H,5-9H2,(H,18,19);/q;+1/p-1 |
| InChIKey | YKCDBPGWURPFNX-UHFFFAOYSA-M |
| XLogP | -2.64 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |