C21H24FNO6S — CID 21305587
[3-[1-[2-(4-fluorophenyl)ethyl]piperidine-4-carbonyl]-2-methoxyphenoxy] hydrogen sulfite (PubChem CID 21305587) has the molecular formula C21H24FNO6S and a molecular weight of 437.49 g/mol. Its IUPAC name is [3-[1-[2-(4-fluorophenyl)ethyl]piperidine-4-carbonyl]-2-methoxyphenoxy] hydrogen sulfite.
| Compound Name | [3-[1-[2-(4-fluorophenyl)ethyl]piperidine-4-carbonyl]-2-methoxyphenoxy] hydrogen sulfite |
|---|---|
| PubChem CID | 21305587 |
| Molecular Formula | C21H24FNO6S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | [3-[1-[2-(4-fluorophenyl)ethyl]piperidine-4-carbonyl]-2-methoxyphenoxy] hydrogen sulfite |
| SMILES | COc1c(OOS(=O)O)cccc1C(=O)C1CCN(CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H24FNO6S/c1-27-21-18(3-2-4-19(21)28-29-30(25)26)20(24)16-10-13-23(14-11-16)12-9-15-5-7-17(22)8-6-15/h2-8,16H,9-14H2,1H3,(H,25,26) |
| InChIKey | YMVDBJFHHNDOFL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|