C20H23ClFN3S — CID 141037025
2-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]sulfanyl-1H-benzimidazole;hydrochloride (PubChem CID 141037025) has the molecular formula C20H23ClFN3S and a molecular weight of 391.94 g/mol. Its IUPAC name is 2-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]sulfanyl-1H-benzimidazole;hydrochloride.
| Compound Name | 2-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]sulfanyl-1H-benzimidazole;hydrochloride |
|---|---|
| PubChem CID | 141037025 |
| Molecular Formula | C20H23ClFN3S |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]sulfanyl-1H-benzimidazole;hydrochloride |
| SMILES | Cl.Fc1ccc(CCN2CCC(Sc3nc4ccccc4[nH]3)CC2)cc1 |
| InChI | InChI=1S/C20H22FN3S.ClH/c21-16-7-5-15(6-8-16)9-12-24-13-10-17(11-14-24)25-20-22-18-3-1-2-4-19(18)23-20;/h1-8,17H,9-14H2,(H,22,23);1H |
| InChIKey | ZAPIAFGFYRUTNP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |