C13H21Cl3N4S — CID 10384617
2-(2-piperazin-1-ylethylsulfanyl)-1H-benzimidazole;trihydrochloride (PubChem CID 10384617) has the molecular formula C13H21Cl3N4S and a molecular weight of 371.77 g/mol. Its IUPAC name is 2-(2-piperazin-1-ylethylsulfanyl)-1H-benzimidazole;trihydrochloride.
| Compound Name | 2-(2-piperazin-1-ylethylsulfanyl)-1H-benzimidazole;trihydrochloride |
|---|---|
| PubChem CID | 10384617 |
| Molecular Formula | C13H21Cl3N4S |
| Molecular Weight | 371.77 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 2-(2-piperazin-1-ylethylsulfanyl)-1H-benzimidazole;trihydrochloride |
| SMILES | Cl.Cl.Cl.c1ccc2[nH]c(SCCN3CCNCC3)nc2c1 |
| InChI | InChI=1S/C13H18N4S.3ClH/c1-2-4-12-11(3-1)15-13(16-12)18-10-9-17-7-5-14-6-8-17;;;/h1-4,14H,5-10H2,(H,15,16);3*1H |
| InChIKey | WOBHYFMVZWBIGN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.77 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |