C14H20ClN3S — CID 126475917
2-(2-piperidin-1-ylethylsulfanyl)-1H-benzimidazole;hydrochloride (PubChem CID 126475917) has the molecular formula C14H20ClN3S and a molecular weight of 297.85 g/mol. Its IUPAC name is 2-(2-piperidin-1-ylethylsulfanyl)-1H-benzimidazole;hydrochloride.
| Compound Name | 2-(2-piperidin-1-ylethylsulfanyl)-1H-benzimidazole;hydrochloride |
|---|---|
| PubChem CID | 126475917 |
| Molecular Formula | C14H20ClN3S |
| Molecular Weight | 297.85 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-(2-piperidin-1-ylethylsulfanyl)-1H-benzimidazole;hydrochloride |
| SMILES | Cl.c1ccc2[nH]c(SCCN3CCCCC3)nc2c1 |
| InChI | InChI=1S/C14H19N3S.ClH/c1-4-8-17(9-5-1)10-11-18-14-15-12-6-2-3-7-13(12)16-14;/h2-3,6-7H,1,4-5,8-11H2,(H,15,16);1H |
| InChIKey | MDNCUXABKZWMON-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.85 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |