C23H25ClFNOS — CID 141037036
1-[2-(4-fluorophenyl)ethyl]-4-naphthalen-2-ylsulfinylpiperidine;hydrochloride (PubChem CID 141037036) has the molecular formula C23H25ClFNOS and a molecular weight of 417.98 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-4-naphthalen-2-ylsulfinylpiperidine;hydrochloride.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-4-naphthalen-2-ylsulfinylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 141037036 |
| Molecular Formula | C23H25ClFNOS |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-4-naphthalen-2-ylsulfinylpiperidine;hydrochloride |
| SMILES | Cl.O=S(c1ccc2ccccc2c1)C1CCN(CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H24FNOS.ClH/c24-21-8-5-18(6-9-21)11-14-25-15-12-22(13-16-25)27(26)23-10-7-19-3-1-2-4-20(19)17-23;/h1-10,17,22H,11-16H2;1H |
| InChIKey | RQZFCKKMKGEGNE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |