C18H23Cl2FN2OS — CID 141037032
4-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]sulfinylpyridine;dihydrochloride (PubChem CID 141037032) has the molecular formula C18H23Cl2FN2OS and a molecular weight of 405.37 g/mol. Its IUPAC name is 4-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]sulfinylpyridine;dihydrochloride.
| Compound Name | 4-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]sulfinylpyridine;dihydrochloride |
|---|---|
| PubChem CID | 141037032 |
| Molecular Formula | C18H23Cl2FN2OS |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 4-[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]sulfinylpyridine;dihydrochloride |
| SMILES | Cl.Cl.O=S(c1ccncc1)C1CCN(CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H21FN2OS.2ClH/c19-16-3-1-15(2-4-16)7-12-21-13-8-18(9-14-21)23(22)17-5-10-20-11-6-17;;/h1-6,10-11,18H,7-9,12-14H2;2*1H |
| InChIKey | NEGYEAVJKDEUFR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |