C26H27FN2O2S — CID 10366515
1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-(naphthalen-2-ylsulfinylmethyl)piperidin-4-ol (PubChem CID 10366515) has the molecular formula C26H27FN2O2S and a molecular weight of 450.58 g/mol. Its IUPAC name is 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-(naphthalen-2-ylsulfinylmethyl)piperidin-4-ol.
| Compound Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-(naphthalen-2-ylsulfinylmethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 10366515 |
| Molecular Formula | C26H27FN2O2S |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-4-(naphthalen-2-ylsulfinylmethyl)piperidin-4-ol |
| SMILES | O=S(CC1(O)CCN(CCc2c[nH]c3ccc(F)cc23)CC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H27FN2O2S/c27-22-6-8-25-24(16-22)21(17-28-25)9-12-29-13-10-26(30,11-14-29)18-32(31)23-7-5-19-3-1-2-4-20(19)15-23/h1-8,15-17,28,30H,9-14,18H2 |
| InChIKey | YPKSAFDKUNDMOL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |