C23H23FN2O — CID 162755258
1-benzyl-4-ethynyl-3-[(5-fluoro-1H-indol-3-yl)methyl]piperidin-4-ol (PubChem CID 162755258) has the molecular formula C23H23FN2O and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-benzyl-4-ethynyl-3-[(5-fluoro-1H-indol-3-yl)methyl]piperidin-4-ol.
| Compound Name | 1-benzyl-4-ethynyl-3-[(5-fluoro-1H-indol-3-yl)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 162755258 |
| Molecular Formula | C23H23FN2O |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1-benzyl-4-ethynyl-3-[(5-fluoro-1H-indol-3-yl)methyl]piperidin-4-ol |
| SMILES | C#CC1(O)CCN(Cc2ccccc2)CC1Cc1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C23H23FN2O/c1-2-23(27)10-11-26(15-17-6-4-3-5-7-17)16-19(23)12-18-14-25-22-9-8-20(24)13-21(18)22/h1,3-9,13-14,19,25,27H,10-12,15-16H2 |
| InChIKey | NSKSKQIUYXTIFL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|