C13H15FN2 — CID 96783850
5-fluoro-3-[[(2R)-pyrrolidin-2-yl]methyl]-1H-indole (PubChem CID 96783850) has the molecular formula C13H15FN2 and a molecular weight of 218.28 g/mol. Its IUPAC name is 5-fluoro-3-[[(2R)-pyrrolidin-2-yl]methyl]-1H-indole.
| Compound Name | 5-fluoro-3-[[(2R)-pyrrolidin-2-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 96783850 |
| Molecular Formula | C13H15FN2 |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 5-fluoro-3-[[(2R)-pyrrolidin-2-yl]methyl]-1H-indole |
| SMILES | Fc1ccc2[nH]cc(C[C@H]3CCCN3)c2c1 |
| InChI | InChI=1S/C13H15FN2/c14-10-3-4-13-12(7-10)9(8-16-13)6-11-2-1-5-15-11/h3-4,7-8,11,15-16H,1-2,5-6H2/t11-/m1/s1 |
| InChIKey | WLUNPDCMUWDXBU-LLVKDONJSA-N |
| XLogP | 2.60 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |