C25H38FN5O — CID 139906828
2-(5-fluoro-1H-indol-3-yl)-1-[4-[[4-[[(2S)-pyrrolidin-2-yl]methylamino]butylamino]methyl]piperidin-1-yl]ethanone (PubChem CID 139906828) has the molecular formula C25H38FN5O and a molecular weight of 443.61 g/mol. Its IUPAC name is 2-(5-fluoro-1H-indol-3-yl)-1-[4-[[4-[[(2S)-pyrrolidin-2-yl]methylamino]butylamino]methyl]piperidin-1-yl]ethanone.
| Compound Name | 2-(5-fluoro-1H-indol-3-yl)-1-[4-[[4-[[(2S)-pyrrolidin-2-yl]methylamino]butylamino]methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 139906828 |
| Molecular Formula | C25H38FN5O |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.31 |
| IUPAC Name | 2-(5-fluoro-1H-indol-3-yl)-1-[4-[[4-[[(2S)-pyrrolidin-2-yl]methylamino]butylamino]methyl]piperidin-1-yl]ethanone |
| SMILES | O=C(Cc1c[nH]c2ccc(F)cc12)N1CCC(CNCCCCNC[C@@H]2CCCN2)CC1 |
| InChI | InChI=1S/C25H38FN5O/c26-21-5-6-24-23(15-21)20(17-30-24)14-25(32)31-12-7-19(8-13-31)16-27-9-1-2-10-28-18-22-4-3-11-29-22/h5-6,15,17,19,22,27-30H,1-4,7-14,16,18H2/t22-/m0/s1 |
| InChIKey | YTXVDZLPDQHWCH-QFIPXVFZSA-N |
| XLogP | 2.80 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|