C25H30FN3O2 — CID 169087243
[4-[[3-(5-fluoro-1H-indol-3-yl)propylamino]methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone (PubChem CID 169087243) has the molecular formula C25H30FN3O2 and a molecular weight of 423.53 g/mol. Its IUPAC name is [4-[[3-(5-fluoro-1H-indol-3-yl)propylamino]methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [4-[[3-(5-fluoro-1H-indol-3-yl)propylamino]methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 169087243 |
| Molecular Formula | C25H30FN3O2 |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | [4-[[3-(5-fluoro-1H-indol-3-yl)propylamino]methyl]piperidin-1-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCC(CNCCCc3c[nH]c4ccc(F)cc34)CC2)cc1 |
| InChI | InChI=1S/C25H30FN3O2/c1-31-22-7-4-19(5-8-22)25(30)29-13-10-18(11-14-29)16-27-12-2-3-20-17-28-24-9-6-21(26)15-23(20)24/h4-9,15,17-18,27-28H,2-3,10-14,16H2,1H3 |
| InChIKey | NDJVCQUKCYXDPU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|