C21H23FN4O — CID 146083897
6-(cyclopropylmethylamino)-N-[3-(5-fluoro-1H-indol-3-yl)propyl]pyridine-3-carboxamide (PubChem CID 146083897) has the molecular formula C21H23FN4O and a molecular weight of 366.44 g/mol. Its IUPAC name is 6-(cyclopropylmethylamino)-N-[3-(5-fluoro-1H-indol-3-yl)propyl]pyridine-3-carboxamide.
| Compound Name | 6-(cyclopropylmethylamino)-N-[3-(5-fluoro-1H-indol-3-yl)propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146083897 |
| Molecular Formula | C21H23FN4O |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 6-(cyclopropylmethylamino)-N-[3-(5-fluoro-1H-indol-3-yl)propyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCCc1c[nH]c2ccc(F)cc12)c1ccc(NCC2CC2)nc1 |
| InChI | InChI=1S/C21H23FN4O/c22-17-6-7-19-18(10-17)15(12-24-19)2-1-9-23-21(27)16-5-8-20(26-13-16)25-11-14-3-4-14/h5-8,10,12-14,24H,1-4,9,11H2,(H,23,27)(H,25,26) |
| InChIKey | JABAPSCZHRBIQQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|