C23H34FN5O2 — CID 111972126
tert-butyl 4-[[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 111972126) has the molecular formula C23H34FN5O2 and a molecular weight of 431.56 g/mol. Its IUPAC name is tert-butyl 4-[[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111972126 |
| Molecular Formula | C23H34FN5O2 |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | tert-butyl 4-[[[N-[2-(5-fluoro-1H-indol-3-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H34FN5O2/c1-23(2,3)31-22(30)29-11-8-16(9-12-29)14-28-21(25-4)26-10-7-17-15-27-20-6-5-18(24)13-19(17)20/h5-6,13,15-16,27H,7-12,14H2,1-4H3,(H2,25,26,28) |
| InChIKey | RVKICVQHRUXEAJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|