C19H28FN5 — CID 111972392
1-[(1-ethylpyrrolidin-3-yl)methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 111972392) has the molecular formula C19H28FN5 and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-3-yl)methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[(1-ethylpyrrolidin-3-yl)methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111972392 |
| Molecular Formula | C19H28FN5 |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-3-yl)methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | CCN1CCC(CN/C(=N\C)NCCc2c[nH]c3ccc(F)cc23)C1 |
| InChI | InChI=1S/C19H28FN5/c1-3-25-9-7-14(13-25)11-24-19(21-2)22-8-6-15-12-23-18-5-4-16(20)10-17(15)18/h4-5,10,12,14,23H,3,6-9,11,13H2,1-2H3,(H2,21,22,24) |
| InChIKey | DFYHOQQUFDXCAM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|