C23H23N3S — CID 19702143
4-benzyl-2-[3-(pyrrolidin-2-ylmethyl)-1H-indol-5-yl]-1,3-thiazole (PubChem CID 19702143) has the molecular formula C23H23N3S and a molecular weight of 373.53 g/mol. Its IUPAC name is 4-benzyl-2-[3-(pyrrolidin-2-ylmethyl)-1H-indol-5-yl]-1,3-thiazole.
| Compound Name | 4-benzyl-2-[3-(pyrrolidin-2-ylmethyl)-1H-indol-5-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 19702143 |
| Molecular Formula | C23H23N3S |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 4-benzyl-2-[3-(pyrrolidin-2-ylmethyl)-1H-indol-5-yl]-1,3-thiazole |
| SMILES | c1ccc(Cc2csc(-c3ccc4[nH]cc(CC5CCCN5)c4c3)n2)cc1 |
| InChI | InChI=1S/C23H23N3S/c1-2-5-16(6-3-1)11-20-15-27-23(26-20)17-8-9-22-21(13-17)18(14-25-22)12-19-7-4-10-24-19/h1-3,5-6,8-9,13-15,19,24-25H,4,7,10-12H2 |
| InChIKey | VIRILPQYDWEEED-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |