C18H20F2N2 — CID 164862876
1-benzyl-4-(2,5-difluorophenyl)piperidin-4-amine (PubChem CID 164862876) has the molecular formula C18H20F2N2 and a molecular weight of 302.37 g/mol. Its IUPAC name is 1-benzyl-4-(2,5-difluorophenyl)piperidin-4-amine.
| Compound Name | 1-benzyl-4-(2,5-difluorophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 164862876 |
| Molecular Formula | C18H20F2N2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-benzyl-4-(2,5-difluorophenyl)piperidin-4-amine |
| SMILES | NC1(c2cc(F)ccc2F)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H20F2N2/c19-15-6-7-17(20)16(12-15)18(21)8-10-22(11-9-18)13-14-4-2-1-3-5-14/h1-7,12H,8-11,13,21H2 |
| InChIKey | VMZZYAYUHRUUOS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |