C25H29NO4S2 — CID 24730901
1-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-thiophen-2-ylphenyl)sulfonylpiperidine (PubChem CID 24730901) has the molecular formula C25H29NO4S2 and a molecular weight of 471.64 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-thiophen-2-ylphenyl)sulfonylpiperidine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-thiophen-2-ylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 24730901 |
| Molecular Formula | C25H29NO4S2 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-thiophen-2-ylphenyl)sulfonylpiperidine |
| SMILES | COc1ccc(CCN2CCC(S(=O)(=O)c3ccc(-c4cccs4)cc3)CC2)cc1OC |
| InChI | InChI=1S/C25H29NO4S2/c1-29-23-10-5-19(18-24(23)30-2)11-14-26-15-12-22(13-16-26)32(27,28)21-8-6-20(7-9-21)25-4-3-17-31-25/h3-10,17-18,22H,11-16H2,1-2H3 |
| InChIKey | NUGNHVUPZYMHOA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |