C25H30N2O2S2 — CID 24730862
N,N-dimethyl-4-[2-[4-(4-thiophen-3-ylphenyl)sulfonylpiperidin-1-yl]ethyl]aniline (PubChem CID 24730862) has the molecular formula C25H30N2O2S2 and a molecular weight of 454.66 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-[4-(4-thiophen-3-ylphenyl)sulfonylpiperidin-1-yl]ethyl]aniline.
| Compound Name | N,N-dimethyl-4-[2-[4-(4-thiophen-3-ylphenyl)sulfonylpiperidin-1-yl]ethyl]aniline |
|---|---|
| PubChem CID | 24730862 |
| Molecular Formula | C25H30N2O2S2 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N,N-dimethyl-4-[2-[4-(4-thiophen-3-ylphenyl)sulfonylpiperidin-1-yl]ethyl]aniline |
| SMILES | CN(C)c1ccc(CCN2CCC(S(=O)(=O)c3ccc(-c4ccsc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H30N2O2S2/c1-26(2)23-7-3-20(4-8-23)11-15-27-16-12-25(13-17-27)31(28,29)24-9-5-21(6-10-24)22-14-18-30-19-22/h3-10,14,18-19,25H,11-13,15-17H2,1-2H3 |
| InChIKey | OQZSDTCKYXOKLO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|