C17H27N3O2 — CID 68707772
[1-[2-[4-(dimethylamino)phenyl]ethyl]piperidin-4-yl]methylcarbamic acid (PubChem CID 68707772) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is [1-[2-[4-(dimethylamino)phenyl]ethyl]piperidin-4-yl]methylcarbamic acid.
| Compound Name | [1-[2-[4-(dimethylamino)phenyl]ethyl]piperidin-4-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 68707772 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | [1-[2-[4-(dimethylamino)phenyl]ethyl]piperidin-4-yl]methylcarbamic acid |
| SMILES | CN(C)c1ccc(CCN2CCC(CNC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C17H27N3O2/c1-19(2)16-5-3-14(4-6-16)7-10-20-11-8-15(9-12-20)13-18-17(21)22/h3-6,15,18H,7-13H2,1-2H3,(H,21,22) |
| InChIKey | UVSYEXFRSDIXLZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|