C21H20ClFN2O3S — CID 67170382
[4-(4-chlorophenyl)sulfonylpiperidin-1-yl]-(6-fluoro-1-methylindol-2-yl)methanone (PubChem CID 67170382) has the molecular formula C21H20ClFN2O3S and a molecular weight of 434.92 g/mol. Its IUPAC name is [4-(4-chlorophenyl)sulfonylpiperidin-1-yl]-(6-fluoro-1-methylindol-2-yl)methanone.
| Compound Name | [4-(4-chlorophenyl)sulfonylpiperidin-1-yl]-(6-fluoro-1-methylindol-2-yl)methanone |
|---|---|
| PubChem CID | 67170382 |
| Molecular Formula | C21H20ClFN2O3S |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | [4-(4-chlorophenyl)sulfonylpiperidin-1-yl]-(6-fluoro-1-methylindol-2-yl)methanone |
| SMILES | Cn1c(C(=O)N2CCC(S(=O)(=O)c3ccc(Cl)cc3)CC2)cc2ccc(F)cc21 |
| InChI | InChI=1S/C21H20ClFN2O3S/c1-24-19-13-16(23)5-2-14(19)12-20(24)21(26)25-10-8-18(9-11-25)29(27,28)17-6-3-15(22)4-7-17/h2-7,12-13,18H,8-11H2,1H3 |
| InChIKey | JHSWPGLIOUTXJQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |