C14H14ClNO4S3 — CID 90587859
3-(4-chlorophenyl)sulfonyl-1-thiophen-2-ylsulfonylpyrrolidine (PubChem CID 90587859) has the molecular formula C14H14ClNO4S3 and a molecular weight of 391.92 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-1-thiophen-2-ylsulfonylpyrrolidine.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-1-thiophen-2-ylsulfonylpyrrolidine |
|---|---|
| PubChem CID | 90587859 |
| Molecular Formula | C14H14ClNO4S3 |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-1-thiophen-2-ylsulfonylpyrrolidine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)C1CCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C14H14ClNO4S3/c15-11-3-5-12(6-4-11)22(17,18)13-7-8-16(10-13)23(19,20)14-2-1-9-21-14/h1-6,9,13H,7-8,10H2 |
| InChIKey | PFDRVUKMIDQTDK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |