C11H18N2O5S — CID 65310670
2-(3-aminophenoxy)-N-(1,3-dihydroxypropan-2-yl)ethanesulfonamide (PubChem CID 65310670) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-(3-aminophenoxy)-N-(1,3-dihydroxypropan-2-yl)ethanesulfonamide.
| Compound Name | 2-(3-aminophenoxy)-N-(1,3-dihydroxypropan-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 65310670 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-(3-aminophenoxy)-N-(1,3-dihydroxypropan-2-yl)ethanesulfonamide |
| SMILES | Nc1cccc(OCCS(=O)(=O)NC(CO)CO)c1 |
| InChI | InChI=1S/C11H18N2O5S/c12-9-2-1-3-11(6-9)18-4-5-19(16,17)13-10(7-14)8-15/h1-3,6,10,13-15H,4-5,7-8,12H2 |
| InChIKey | GQJBKLITAWFSRA-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|