C12H18F2N2O4S — CID 107478035
2-(3-aminophenoxy)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)ethanesulfonamide (PubChem CID 107478035) has the molecular formula C12H18F2N2O4S and a molecular weight of 324.35 g/mol. Its IUPAC name is 2-(3-aminophenoxy)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)ethanesulfonamide.
| Compound Name | 2-(3-aminophenoxy)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 107478035 |
| Molecular Formula | C12H18F2N2O4S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-(3-aminophenoxy)-N-(2,2-difluoroethyl)-N-(2-hydroxyethyl)ethanesulfonamide |
| SMILES | Nc1cccc(OCCS(=O)(=O)N(CCO)CC(F)F)c1 |
| InChI | InChI=1S/C12H18F2N2O4S/c13-12(14)9-16(4-5-17)21(18,19)7-6-20-11-3-1-2-10(15)8-11/h1-3,8,12,17H,4-7,9,15H2 |
| InChIKey | SFBXXOYHTJOULW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|