C13H22N2O4S2 — CID 106153272
2-(3-aminophenoxy)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)ethanesulfonamide (PubChem CID 106153272) has the molecular formula C13H22N2O4S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-(3-aminophenoxy)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)ethanesulfonamide.
| Compound Name | 2-(3-aminophenoxy)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 106153272 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-(3-aminophenoxy)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)ethanesulfonamide |
| SMILES | CSC(CO)C(C)NS(=O)(=O)CCOc1cccc(N)c1 |
| InChI | InChI=1S/C13H22N2O4S2/c1-10(13(9-16)20-2)15-21(17,18)7-6-19-12-5-3-4-11(14)8-12/h3-5,8,10,13,15-16H,6-7,9,14H2,1-2H3 |
| InChIKey | RZVSBSWLDAAPRX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|