C12H19NO3S — CID 79681829
3-[3-(3-aminophenoxy)propylsulfanyl]propane-1,2-diol (PubChem CID 79681829) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 3-[3-(3-aminophenoxy)propylsulfanyl]propane-1,2-diol.
| Compound Name | 3-[3-(3-aminophenoxy)propylsulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 79681829 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-[3-(3-aminophenoxy)propylsulfanyl]propane-1,2-diol |
| SMILES | Nc1cccc(OCCCSCC(O)CO)c1 |
| InChI | InChI=1S/C12H19NO3S/c13-10-3-1-4-12(7-10)16-5-2-6-17-9-11(15)8-14/h1,3-4,7,11,14-15H,2,5-6,8-9,13H2 |
| InChIKey | SPMNQHRULILFNU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|