C13H22N2O3S — CID 105006850
2-tert-butylsulfonyl-N-[(6-methoxy-3-pyridinyl)methyl]ethanamine (PubChem CID 105006850) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-tert-butylsulfonyl-N-[(6-methoxy-3-pyridinyl)methyl]ethanamine.
| Compound Name | 2-tert-butylsulfonyl-N-[(6-methoxy-3-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 105006850 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-tert-butylsulfonyl-N-[(6-methoxy-3-pyridinyl)methyl]ethanamine |
| SMILES | COc1ccc(CNCCS(=O)(=O)C(C)(C)C)cn1 |
| InChI | InChI=1S/C13H22N2O3S/c1-13(2,3)19(16,17)8-7-14-9-11-5-6-12(18-4)15-10-11/h5-6,10,14H,7-9H2,1-4H3 |
| InChIKey | LMSGDHBJTJQWPJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|