C9H13ClN2O3S — CID 107651707
2-chloro-N-[(6-methoxy-3-pyridinyl)methyl]ethanesulfonamide (PubChem CID 107651707) has the molecular formula C9H13ClN2O3S and a molecular weight of 264.73 g/mol. Its IUPAC name is 2-chloro-N-[(6-methoxy-3-pyridinyl)methyl]ethanesulfonamide.
| Compound Name | 2-chloro-N-[(6-methoxy-3-pyridinyl)methyl]ethanesulfonamide |
|---|---|
| PubChem CID | 107651707 |
| Molecular Formula | C9H13ClN2O3S |
| Molecular Weight | 264.73 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 2-chloro-N-[(6-methoxy-3-pyridinyl)methyl]ethanesulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)CCCl)cn1 |
| InChI | InChI=1S/C9H13ClN2O3S/c1-15-9-3-2-8(6-11-9)7-12-16(13,14)5-4-10/h2-3,6,12H,4-5,7H2,1H3 |
| InChIKey | OFNOHCVRFHCRIN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.73 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|