C13H12Cl2N2O3S — CID 134036423
3,4-dichloro-N-[(6-methoxy-3-pyridinyl)methyl]benzenesulfonamide (PubChem CID 134036423) has the molecular formula C13H12Cl2N2O3S and a molecular weight of 347.22 g/mol. Its IUPAC name is 3,4-dichloro-N-[(6-methoxy-3-pyridinyl)methyl]benzenesulfonamide.
| Compound Name | 3,4-dichloro-N-[(6-methoxy-3-pyridinyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134036423 |
| Molecular Formula | C13H12Cl2N2O3S |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 3,4-dichloro-N-[(6-methoxy-3-pyridinyl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2ccc(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C13H12Cl2N2O3S/c1-20-13-5-2-9(7-16-13)8-17-21(18,19)10-3-4-11(14)12(15)6-10/h2-7,17H,8H2,1H3 |
| InChIKey | QLCRDJAPWSKGEY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |