C12H20BrN3O2 — CID 80861009
5-bromo-4-(2-butoxyethoxy)-N-ethylpyrimidin-2-amine (PubChem CID 80861009) has the molecular formula C12H20BrN3O2 and a molecular weight of 318.22 g/mol. Its IUPAC name is 5-bromo-4-(2-butoxyethoxy)-N-ethylpyrimidin-2-amine.
| Compound Name | 5-bromo-4-(2-butoxyethoxy)-N-ethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80861009 |
| Molecular Formula | C12H20BrN3O2 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 5-bromo-4-(2-butoxyethoxy)-N-ethylpyrimidin-2-amine |
| SMILES | CCCCOCCOc1nc(NCC)ncc1Br |
| InChI | InChI=1S/C12H20BrN3O2/c1-3-5-6-17-7-8-18-11-10(13)9-15-12(16-11)14-4-2/h9H,3-8H2,1-2H3,(H,14,15,16) |
| InChIKey | NLHZVVLFCSLKNQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|