C9H14BrN3O2 — CID 80866531
3-[5-bromo-2-(ethylamino)pyrimidin-4-yl]oxypropan-1-ol (PubChem CID 80866531) has the molecular formula C9H14BrN3O2 and a molecular weight of 276.13 g/mol. Its IUPAC name is 3-[5-bromo-2-(ethylamino)pyrimidin-4-yl]oxypropan-1-ol.
| Compound Name | 3-[5-bromo-2-(ethylamino)pyrimidin-4-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 80866531 |
| Molecular Formula | C9H14BrN3O2 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 3-[5-bromo-2-(ethylamino)pyrimidin-4-yl]oxypropan-1-ol |
| SMILES | CCNc1ncc(Br)c(OCCCO)n1 |
| InChI | InChI=1S/C9H14BrN3O2/c1-2-11-9-12-6-7(10)8(13-9)15-5-3-4-14/h6,14H,2-5H2,1H3,(H,11,12,13) |
| InChIKey | BEIUQQDCFSAOEC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|