C11H18BrN3O — CID 80861907
5-bromo-N-ethyl-4-(2-methylbutan-2-yloxy)pyrimidin-2-amine (PubChem CID 80861907) has the molecular formula C11H18BrN3O and a molecular weight of 288.19 g/mol. Its IUPAC name is 5-bromo-N-ethyl-4-(2-methylbutan-2-yloxy)pyrimidin-2-amine.
| Compound Name | 5-bromo-N-ethyl-4-(2-methylbutan-2-yloxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80861907 |
| Molecular Formula | C11H18BrN3O |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-bromo-N-ethyl-4-(2-methylbutan-2-yloxy)pyrimidin-2-amine |
| SMILES | CCNc1ncc(Br)c(OC(C)(C)CC)n1 |
| InChI | InChI=1S/C11H18BrN3O/c1-5-11(3,4)16-9-8(12)7-14-10(15-9)13-6-2/h7H,5-6H2,1-4H3,(H,13,14,15) |
| InChIKey | MYJSPVFXIXFPNZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |