C13H11BrF3N3O — CID 80864968
5-bromo-N-ethyl-4-[2-(trifluoromethyl)phenoxy]pyrimidin-2-amine (PubChem CID 80864968) has the molecular formula C13H11BrF3N3O and a molecular weight of 362.15 g/mol. Its IUPAC name is 5-bromo-N-ethyl-4-[2-(trifluoromethyl)phenoxy]pyrimidin-2-amine.
| Compound Name | 5-bromo-N-ethyl-4-[2-(trifluoromethyl)phenoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 80864968 |
| Molecular Formula | C13H11BrF3N3O |
| Molecular Weight | 362.15 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 5-bromo-N-ethyl-4-[2-(trifluoromethyl)phenoxy]pyrimidin-2-amine |
| SMILES | CCNc1ncc(Br)c(Oc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C13H11BrF3N3O/c1-2-18-12-19-7-9(14)11(20-12)21-10-6-4-3-5-8(10)13(15,16)17/h3-7H,2H2,1H3,(H,18,19,20) |
| InChIKey | NCQBQURAGLKCJR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.15 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |