C14H16BrN3O2 — CID 107710279
2-[4-[5-bromo-2-(ethylamino)pyrimidin-4-yl]oxyphenyl]ethanol (PubChem CID 107710279) has the molecular formula C14H16BrN3O2 and a molecular weight of 338.21 g/mol. Its IUPAC name is 2-[4-[5-bromo-2-(ethylamino)pyrimidin-4-yl]oxyphenyl]ethanol.
| Compound Name | 2-[4-[5-bromo-2-(ethylamino)pyrimidin-4-yl]oxyphenyl]ethanol |
|---|---|
| PubChem CID | 107710279 |
| Molecular Formula | C14H16BrN3O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 2-[4-[5-bromo-2-(ethylamino)pyrimidin-4-yl]oxyphenyl]ethanol |
| SMILES | CCNc1ncc(Br)c(Oc2ccc(CCO)cc2)n1 |
| InChI | InChI=1S/C14H16BrN3O2/c1-2-16-14-17-9-12(15)13(18-14)20-11-5-3-10(4-6-11)7-8-19/h3-6,9,19H,2,7-8H2,1H3,(H,16,17,18) |
| InChIKey | RLJWHPQVNJSGSI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |