C15H18FN3O2 — CID 80874712
N-ethyl-5-fluoro-4-[4-(2-methoxyethyl)phenoxy]pyrimidin-2-amine (PubChem CID 80874712) has the molecular formula C15H18FN3O2 and a molecular weight of 291.33 g/mol. Its IUPAC name is N-ethyl-5-fluoro-4-[4-(2-methoxyethyl)phenoxy]pyrimidin-2-amine.
| Compound Name | N-ethyl-5-fluoro-4-[4-(2-methoxyethyl)phenoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 80874712 |
| Molecular Formula | C15H18FN3O2 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-ethyl-5-fluoro-4-[4-(2-methoxyethyl)phenoxy]pyrimidin-2-amine |
| SMILES | CCNc1ncc(F)c(Oc2ccc(CCOC)cc2)n1 |
| InChI | InChI=1S/C15H18FN3O2/c1-3-17-15-18-10-13(16)14(19-15)21-12-6-4-11(5-7-12)8-9-20-2/h4-7,10H,3,8-9H2,1-2H3,(H,17,18,19) |
| InChIKey | DFDDFTSATCJEPI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |