C13H14BrN3O2 — CID 80874710
5-bromo-4-[4-(2-methoxyethyl)phenoxy]pyrimidin-2-amine (PubChem CID 80874710) has the molecular formula C13H14BrN3O2 and a molecular weight of 324.18 g/mol. Its IUPAC name is 5-bromo-4-[4-(2-methoxyethyl)phenoxy]pyrimidin-2-amine.
| Compound Name | 5-bromo-4-[4-(2-methoxyethyl)phenoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 80874710 |
| Molecular Formula | C13H14BrN3O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 5-bromo-4-[4-(2-methoxyethyl)phenoxy]pyrimidin-2-amine |
| SMILES | COCCc1ccc(Oc2nc(N)ncc2Br)cc1 |
| InChI | InChI=1S/C13H14BrN3O2/c1-18-7-6-9-2-4-10(5-3-9)19-12-11(14)8-16-13(15)17-12/h2-5,8H,6-7H2,1H3,(H2,15,16,17) |
| InChIKey | WYQOIIPWXMUCAL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |