C12H15Br2NO3 — CID 43774802
3-[(3,5-dibromo-4-ethoxyphenyl)methylamino]propanoic acid (PubChem CID 43774802) has the molecular formula C12H15Br2NO3 and a molecular weight of 381.06 g/mol. Its IUPAC name is 3-[(3,5-dibromo-4-ethoxyphenyl)methylamino]propanoic acid.
| Compound Name | 3-[(3,5-dibromo-4-ethoxyphenyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 43774802 |
| Molecular Formula | C12H15Br2NO3 |
| Molecular Weight | 381.06 g/mol |
| Exact Mass | 378.94 |
| IUPAC Name | 3-[(3,5-dibromo-4-ethoxyphenyl)methylamino]propanoic acid |
| SMILES | CCOc1c(Br)cc(CNCCC(=O)O)cc1Br |
| InChI | InChI=1S/C12H15Br2NO3/c1-2-18-12-9(13)5-8(6-10(12)14)7-15-4-3-11(16)17/h5-6,15H,2-4,7H2,1H3,(H,16,17) |
| InChIKey | FTMCFXNJKRUFBJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.06 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|