C14H21Br2NO2 — CID 104588408
N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-propan-2-yloxyethanamine (PubChem CID 104588408) has the molecular formula C14H21Br2NO2 and a molecular weight of 395.14 g/mol. Its IUPAC name is N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-propan-2-yloxyethanamine.
| Compound Name | N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-propan-2-yloxyethanamine |
|---|---|
| PubChem CID | 104588408 |
| Molecular Formula | C14H21Br2NO2 |
| Molecular Weight | 395.14 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | N-[(3,5-dibromo-4-ethoxyphenyl)methyl]-2-propan-2-yloxyethanamine |
| SMILES | CCOc1c(Br)cc(CNCCOC(C)C)cc1Br |
| InChI | InChI=1S/C14H21Br2NO2/c1-4-18-14-12(15)7-11(8-13(14)16)9-17-5-6-19-10(2)3/h7-8,10,17H,4-6,9H2,1-3H3 |
| InChIKey | WMXDILMEWJSAEU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.14 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|