C18H30BrNO3 — CID 29227055
N-[(3-bromo-5-ethoxy-4-propoxyphenyl)methyl]-3-propan-2-yloxypropan-1-amine (PubChem CID 29227055) has the molecular formula C18H30BrNO3 and a molecular weight of 388.35 g/mol. Its IUPAC name is N-[(3-bromo-5-ethoxy-4-propoxyphenyl)methyl]-3-propan-2-yloxypropan-1-amine.
| Compound Name | N-[(3-bromo-5-ethoxy-4-propoxyphenyl)methyl]-3-propan-2-yloxypropan-1-amine |
|---|---|
| PubChem CID | 29227055 |
| Molecular Formula | C18H30BrNO3 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-[(3-bromo-5-ethoxy-4-propoxyphenyl)methyl]-3-propan-2-yloxypropan-1-amine |
| SMILES | CCCOc1c(Br)cc(CNCCCOC(C)C)cc1OCC |
| InChI | InChI=1S/C18H30BrNO3/c1-5-9-23-18-16(19)11-15(12-17(18)21-6-2)13-20-8-7-10-22-14(3)4/h11-12,14,20H,5-10,13H2,1-4H3 |
| InChIKey | PKSVVMQINIPATG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|