C21H26BrCl2NO3 — CID 17209125
N-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-propan-2-yloxypropan-1-amine (PubChem CID 17209125) has the molecular formula C21H26BrCl2NO3 and a molecular weight of 491.25 g/mol. Its IUPAC name is N-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-propan-2-yloxypropan-1-amine.
| Compound Name | N-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-propan-2-yloxypropan-1-amine |
|---|---|
| PubChem CID | 17209125 |
| Molecular Formula | C21H26BrCl2NO3 |
| Molecular Weight | 491.25 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | N-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-3-propan-2-yloxypropan-1-amine |
| SMILES | COc1cc(CNCCCOC(C)C)cc(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H26BrCl2NO3/c1-14(2)27-8-4-7-25-12-16-9-17(22)21(20(11-16)26-3)28-13-15-5-6-18(23)19(24)10-15/h5-6,9-11,14,25H,4,7-8,12-13H2,1-3H3 |
| InChIKey | SBTSUHMFLUEVJR-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.25 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|