C19H23BrCl2N2O2 — CID 17056925
N'-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine (PubChem CID 17056925) has the molecular formula C19H23BrCl2N2O2 and a molecular weight of 462.22 g/mol. Its IUPAC name is N'-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 17056925 |
| Molecular Formula | C19H23BrCl2N2O2 |
| Molecular Weight | 462.22 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | N'-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNCc1cc(Br)c(OCc2ccc(Cl)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C19H23BrCl2N2O2/c1-23-6-3-7-24-11-14-8-15(20)19(18(10-14)25-2)26-12-13-4-5-16(21)17(22)9-13/h4-5,8-10,23-24H,3,6-7,11-12H2,1-2H3 |
| InChIKey | DRMJLUWTACJSKN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.22 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|