C18H24BrN3O2 — CID 2988909
N'-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]-N-methylpropane-1,3-diamine (PubChem CID 2988909) has the molecular formula C18H24BrN3O2 and a molecular weight of 394.31 g/mol. Its IUPAC name is N'-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 2988909 |
| Molecular Formula | C18H24BrN3O2 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N'-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNCc1cc(Br)c(OCc2cccnc2)c(OC)c1 |
| InChI | InChI=1S/C18H24BrN3O2/c1-20-6-4-8-22-12-15-9-16(19)18(17(10-15)23-2)24-13-14-5-3-7-21-11-14/h3,5,7,9-11,20,22H,4,6,8,12-13H2,1-2H3 |
| InChIKey | HFRJBFPKWSLIFZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|