C17H22BrClN2O2 — CID 2994076
N-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]propan-1-amine;hydrochloride (PubChem CID 2994076) has the molecular formula C17H22BrClN2O2 and a molecular weight of 401.73 g/mol. Its IUPAC name is N-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]propan-1-amine;hydrochloride.
| Compound Name | N-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 2994076 |
| Molecular Formula | C17H22BrClN2O2 |
| Molecular Weight | 401.73 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N-[[3-bromo-5-methoxy-4-(pyridin-3-ylmethoxy)phenyl]methyl]propan-1-amine;hydrochloride |
| SMILES | CCCNCc1cc(Br)c(OCc2cccnc2)c(OC)c1.Cl |
| InChI | InChI=1S/C17H21BrN2O2.ClH/c1-3-6-19-11-14-8-15(18)17(16(9-14)21-2)22-12-13-5-4-7-20-10-13;/h4-5,7-10,19H,3,6,11-12H2,1-2H3;1H |
| InChIKey | CABBYCMVAYIGKU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.73 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|